C18H22N6O3 — CID 60545132
2-(2-nitrophenyl)-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]acetamide (PubChem CID 60545132) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(2-nitrophenyl)-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]acetamide.
| Compound Name | 2-(2-nitrophenyl)-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 60545132 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 2-(2-nitrophenyl)-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]acetamide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])NCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H22N6O3/c25-17(14-15-4-1-2-5-16(15)24(26)27)19-8-9-22-10-12-23(13-11-22)18-20-6-3-7-21-18/h1-7H,8-14H2,(H,19,25) |
| InChIKey | OQZIBYVOAWGUNX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|