C19H22FN5O2 — CID 111165097
4-(4-fluorophenyl)-N'-methyl-N-[(2-nitrophenyl)methyl]piperazine-1-carboximidamide (PubChem CID 111165097) has the molecular formula C19H22FN5O2 and a molecular weight of 371.42 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-methyl-N-[(2-nitrophenyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-methyl-N-[(2-nitrophenyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111165097 |
| Molecular Formula | C19H22FN5O2 |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-methyl-N-[(2-nitrophenyl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccccc1[N+](=O)[O-])N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H22FN5O2/c1-21-19(22-14-15-4-2-3-5-18(15)25(26)27)24-12-10-23(11-13-24)17-8-6-16(20)7-9-17/h2-9H,10-14H2,1H3,(H,21,22) |
| InChIKey | HQZILFZIAQRJLV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|