C17H21FN4O — CID 111165687
4-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111165687) has the molecular formula C17H21FN4O and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111165687 |
| Molecular Formula | C17H21FN4O |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(furan-2-ylmethyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ccco1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H21FN4O/c1-19-17(20-13-16-3-2-12-23-16)22-10-8-21(9-11-22)15-6-4-14(18)5-7-15/h2-7,12H,8-11,13H2,1H3,(H,19,20) |
| InChIKey | UYWCHXRZDAUCCN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|