C18H24FN5O — CID 119130311
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 119130311) has the molecular formula C18H24FN5O and a molecular weight of 345.42 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119130311 |
| Molecular Formula | C18H24FN5O |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(4-fluorophenyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1c(C)noc1C)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H24FN5O/c1-13-17(14(2)25-22-13)12-21-18(20-3)24-10-8-23(9-11-24)16-6-4-15(19)5-7-16/h4-7H,8-12H2,1-3H3,(H,20,21) |
| InChIKey | HRBYYVVMQRFELV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|