C17H23FIN5O — CID 119120524
N'-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 119120524) has the molecular formula C17H23FIN5O and a molecular weight of 459.31 g/mol. Its IUPAC name is N'-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119120524 |
| Molecular Formula | C17H23FIN5O |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | N'-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | Cc1noc(C)c1C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C17H22FN5O.HI/c1-12-16(13(2)24-21-12)11-20-17(19)23-9-7-22(8-10-23)15-5-3-14(18)4-6-15;/h3-6H,7-11H2,1-2H3,(H2,19,20);1H |
| InChIKey | OXERHSJIVWYCKI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|