C16H23FIN7 — CID 111065961
N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111065961) has the molecular formula C16H23FIN7 and a molecular weight of 459.31 g/mol. Its IUPAC name is N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111065961 |
| Molecular Formula | C16H23FIN7 |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCn1cnnc1C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C16H22FN7.HI/c1-2-22-12-20-21-15(22)11-19-16(18)24-9-7-23(8-10-24)14-5-3-13(17)4-6-14;/h3-6,12H,2,7-11H2,1H3,(H2,18,19);1H |
| InChIKey | MKAOLSNIQLFIOO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|