C18H31FIN5 — CID 111055396
N'-[2-(diethylamino)propyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111055396) has the molecular formula C18H31FIN5 and a molecular weight of 463.38 g/mol. Its IUPAC name is N'-[2-(diethylamino)propyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(diethylamino)propyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111055396 |
| Molecular Formula | C18H31FIN5 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N'-[2-(diethylamino)propyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN(CC)C(C)C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C18H30FN5.HI/c1-4-22(5-2)15(3)14-21-18(20)24-12-10-23(11-13-24)17-8-6-16(19)7-9-17;/h6-9,15H,4-5,10-14H2,1-3H3,(H2,20,21);1H |
| InChIKey | OZOOXTOABMMLQB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|