C19H30FN5O — CID 111802248
4-(4-fluorophenyl)-N'-(2-methyl-3-morpholin-4-ylpropyl)piperazine-1-carboximidamide (PubChem CID 111802248) has the molecular formula C19H30FN5O and a molecular weight of 363.48 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-(2-methyl-3-morpholin-4-ylpropyl)piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-(2-methyl-3-morpholin-4-ylpropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111802248 |
| Molecular Formula | C19H30FN5O |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-(2-methyl-3-morpholin-4-ylpropyl)piperazine-1-carboximidamide |
| SMILES | CC(C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1)CN1CCOCC1 |
| InChI | InChI=1S/C19H30FN5O/c1-16(15-23-10-12-26-13-11-23)14-22-19(21)25-8-6-24(7-9-25)18-4-2-17(20)3-5-18/h2-5,16H,6-15H2,1H3,(H2,21,22) |
| InChIKey | AKRXARUIQWJRQI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|