C16H21FN6 — CID 111064796
4-(4-fluorophenyl)-N'-[(2-methylpyrazol-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111064796) has the molecular formula C16H21FN6 and a molecular weight of 316.38 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[(2-methylpyrazol-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[(2-methylpyrazol-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111064796 |
| Molecular Formula | C16H21FN6 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[(2-methylpyrazol-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | Cn1nccc1C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H21FN6/c1-21-15(6-7-20-21)12-19-16(18)23-10-8-22(9-11-23)14-4-2-13(17)3-5-14/h2-7H,8-12H2,1H3,(H2,18,19) |
| InChIKey | XXIGXEVKCABLID-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 62.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|