C19H31FN6 — CID 111057246
N'-[2-(4-ethylpiperazin-1-yl)ethyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide (PubChem CID 111057246) has the molecular formula C19H31FN6 and a molecular weight of 362.50 g/mol. Its IUPAC name is N'-[2-(4-ethylpiperazin-1-yl)ethyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[2-(4-ethylpiperazin-1-yl)ethyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111057246 |
| Molecular Formula | C19H31FN6 |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | N'-[2-(4-ethylpiperazin-1-yl)ethyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide |
| SMILES | CCN1CCN(CC/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C19H31FN6/c1-2-23-9-11-24(12-10-23)8-7-22-19(21)26-15-13-25(14-16-26)18-5-3-17(20)4-6-18/h3-6H,2,7-16H2,1H3,(H2,21,22) |
| InChIKey | WJDJKAUQBOIPPB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 51.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|