C19H22F2N4 — CID 111025571
4-(4-fluorophenyl)-N'-[2-(4-fluorophenyl)ethyl]piperazine-1-carboximidamide (PubChem CID 111025571) has the molecular formula C19H22F2N4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[2-(4-fluorophenyl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[2-(4-fluorophenyl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111025571 |
| Molecular Formula | C19H22F2N4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[2-(4-fluorophenyl)ethyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\CCc1ccc(F)cc1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H22F2N4/c20-16-3-1-15(2-4-16)9-10-23-19(22)25-13-11-24(12-14-25)18-7-5-17(21)6-8-18/h1-8H,9-14H2,(H2,22,23) |
| InChIKey | AZMKUCBQHZYVDS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|