C15H22FN3 — CID 110919526
N'-[2-(4-fluorophenyl)ethyl]-4-methylpiperidine-1-carboximidamide (PubChem CID 110919526) has the molecular formula C15H22FN3 and a molecular weight of 263.36 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)ethyl]-4-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[2-(4-fluorophenyl)ethyl]-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110919526 |
| Molecular Formula | C15H22FN3 |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | N'-[2-(4-fluorophenyl)ethyl]-4-methylpiperidine-1-carboximidamide |
| SMILES | CC1CCN(/C(N)=N/CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H22FN3/c1-12-7-10-19(11-8-12)15(17)18-9-6-13-2-4-14(16)5-3-13/h2-5,12H,6-11H2,1H3,(H2,17,18) |
| InChIKey | IHLMUWCCEWPSBD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|