C21H29FIN5 — CID 111089178
N'-[2-[4-(dimethylamino)phenyl]ethyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111089178) has the molecular formula C21H29FIN5 and a molecular weight of 497.40 g/mol. Its IUPAC name is N'-[2-[4-(dimethylamino)phenyl]ethyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[2-[4-(dimethylamino)phenyl]ethyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111089178 |
| Molecular Formula | C21H29FIN5 |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | N'-[2-[4-(dimethylamino)phenyl]ethyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CN(C)c1ccc(CC/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)cc1.I |
| InChI | InChI=1S/C21H28FN5.HI/c1-25(2)19-7-3-17(4-8-19)11-12-24-21(23)27-15-13-26(14-16-27)20-9-5-18(22)6-10-20;/h3-10H,11-16H2,1-2H3,(H2,23,24);1H |
| InChIKey | ZZJIOQVLAHLTKR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|