C16H24FN5O — CID 111068257
3-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylpropanamide (PubChem CID 111068257) has the molecular formula C16H24FN5O and a molecular weight of 321.40 g/mol. Its IUPAC name is 3-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylpropanamide.
| Compound Name | 3-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 111068257 |
| Molecular Formula | C16H24FN5O |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 3-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)CC/N=C(\N)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H24FN5O/c1-20(2)15(23)7-8-19-16(18)22-11-9-21(10-12-22)14-5-3-13(17)4-6-14/h3-6H,7-12H2,1-2H3,(H2,18,19) |
| InChIKey | LHZNJBWVPZSNJS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 65.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|