C16H22F4IN5O — CID 111819681
2-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 111819681) has the molecular formula C16H22F4IN5O and a molecular weight of 503.28 g/mol. Its IUPAC name is 2-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111819681 |
| Molecular Formula | C16H22F4IN5O |
| Molecular Weight | 503.28 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | 2-[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | CN(CC(F)(F)F)C(=O)C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C16H21F4N5O.HI/c1-23(11-16(18,19)20)14(26)10-22-15(21)25-8-6-24(7-9-25)13-4-2-12(17)3-5-13;/h2-5H,6-11H2,1H3,(H2,21,22);1H |
| InChIKey | MOJSIEZENRURTF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 65.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|