C14H19BrFIN4 — CID 119120602
N'-(2-bromoprop-2-enyl)-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 119120602) has the molecular formula C14H19BrFIN4 and a molecular weight of 469.14 g/mol. Its IUPAC name is N'-(2-bromoprop-2-enyl)-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(2-bromoprop-2-enyl)-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119120602 |
| Molecular Formula | C14H19BrFIN4 |
| Molecular Weight | 469.14 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | N'-(2-bromoprop-2-enyl)-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | C=C(Br)C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C14H18BrFN4.HI/c1-11(15)10-18-14(17)20-8-6-19(7-9-20)13-4-2-12(16)3-5-13;/h2-5H,1,6-10H2,(H2,17,18);1H |
| InChIKey | WDGLKFVHOMCTJN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.14 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|