C17H24FN5O — CID 111040310
4-(4-fluorophenyl)-N'-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carboximidamide (PubChem CID 111040310) has the molecular formula C17H24FN5O and a molecular weight of 333.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111040310 |
| Molecular Formula | C17H24FN5O |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-(2-oxo-2-pyrrolidin-1-ylethyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CC(=O)N1CCCC1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H24FN5O/c18-14-3-5-15(6-4-14)21-9-11-23(12-10-21)17(19)20-13-16(24)22-7-1-2-8-22/h3-6H,1-2,7-13H2,(H2,19,20) |
| InChIKey | QUBUHNISFHFDMH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 65.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|