C17H25FN4O — CID 111802822
4-(4-fluorophenyl)-N'-[(2-hydroxycyclopentyl)methyl]piperazine-1-carboximidamide (PubChem CID 111802822) has the molecular formula C17H25FN4O and a molecular weight of 320.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[(2-hydroxycyclopentyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[(2-hydroxycyclopentyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111802822 |
| Molecular Formula | C17H25FN4O |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[(2-hydroxycyclopentyl)methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\CC1CCCC1O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H25FN4O/c18-14-4-6-15(7-5-14)21-8-10-22(11-9-21)17(19)20-12-13-2-1-3-16(13)23/h4-7,13,16,23H,1-3,8-12H2,(H2,19,20) |
| InChIKey | BRTUKGGSNHANJL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|