C22H31FIN5S — CID 111819375
4-(4-fluorophenyl)-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111819375) has the molecular formula C22H31FIN5S and a molecular weight of 543.49 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-fluorophenyl)-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111819375 |
| Molecular Formula | C22H31FIN5S |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[(1-methyl-2-thiophen-2-ylpiperidin-3-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CN1CCCC(C/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)C1c1cccs1.I |
| InChI | InChI=1S/C22H30FN5S.HI/c1-26-10-2-4-17(21(26)20-5-3-15-29-20)16-25-22(24)28-13-11-27(12-14-28)19-8-6-18(23)7-9-19;/h3,5-9,15,17,21H,2,4,10-14,16H2,1H3,(H2,24,25);1H |
| InChIKey | GZCGWMLFMDQUOD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|