C20H33FIN5O — CID 111803667
4-(4-fluorophenyl)-N'-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111803667) has the molecular formula C20H33FIN5O and a molecular weight of 505.42 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-fluorophenyl)-N'-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111803667 |
| Molecular Formula | C20H33FIN5O |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[[1-(2-methoxyethyl)piperidin-4-yl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | COCCN1CCC(C/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)CC1.I |
| InChI | InChI=1S/C20H32FN5O.HI/c1-27-15-14-24-8-6-17(7-9-24)16-23-20(22)26-12-10-25(11-13-26)19-4-2-18(21)3-5-19;/h2-5,17H,6-16H2,1H3,(H2,22,23);1H |
| InChIKey | OFUBOGYSEJEXLQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|