C23H34FIN6O — CID 111808353
N'-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111808353) has the molecular formula C23H34FIN6O and a molecular weight of 556.47 g/mol. Its IUPAC name is N'-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111808353 |
| Molecular Formula | C23H34FIN6O |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | N'-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | Cc1nc(CN2CCC(C/N=C(\N)N3CCN(c4ccc(F)cc4)CC3)CC2)oc1C.I |
| InChI | InChI=1S/C23H33FN6O.HI/c1-17-18(2)31-22(27-17)16-28-9-7-19(8-10-28)15-26-23(25)30-13-11-29(12-14-30)21-5-3-20(24)4-6-21;/h3-6,19H,7-16H2,1-2H3,(H2,25,26);1H |
| InChIKey | CKSXPJVAUXBNTK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|