C22H27F3IN5 — CID 111084722
N'-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111084722) has the molecular formula C22H27F3IN5 and a molecular weight of 545.39 g/mol. Its IUPAC name is N'-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111084722 |
| Molecular Formula | C22H27F3IN5 |
| Molecular Weight | 545.39 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | N'-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1CCN(c2ccc(F)c(F)c2)C1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C22H26F3N5.HI/c23-17-1-3-18(4-2-17)28-9-11-29(12-10-28)22(26)27-14-16-7-8-30(15-16)19-5-6-20(24)21(25)13-19;/h1-6,13,16H,7-12,14-15H2,(H2,26,27);1H |
| InChIKey | ARAQWDHEVDHYQS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|