C18H28ClN5 — CID 111065570
4-(4-chlorophenyl)-N'-[(1-ethylpyrrolidin-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111065570) has the molecular formula C18H28ClN5 and a molecular weight of 349.91 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[(1-ethylpyrrolidin-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-[(1-ethylpyrrolidin-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111065570 |
| Molecular Formula | C18H28ClN5 |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[(1-ethylpyrrolidin-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | CCN1CCC(C/N=C(\N)N2CCN(c3ccc(Cl)cc3)CC2)C1 |
| InChI | InChI=1S/C18H28ClN5/c1-2-22-8-7-15(14-22)13-21-18(20)24-11-9-23(10-12-24)17-5-3-16(19)4-6-17/h3-6,15H,2,7-14H2,1H3,(H2,20,21) |
| InChIKey | KGJZQUKZTULJNC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|