C23H30ClN5O — CID 110028858
4-(4-chlorophenyl)-N'-[[2-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 110028858) has the molecular formula C23H30ClN5O and a molecular weight of 427.98 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[[2-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-[[2-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110028858 |
| Molecular Formula | C23H30ClN5O |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[[2-[(3-hydroxypyrrolidin-1-yl)methyl]phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccccc1CN1CCC(O)C1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H30ClN5O/c24-20-5-7-21(8-6-20)28-11-13-29(14-12-28)23(25)26-15-18-3-1-2-4-19(18)16-27-10-9-22(30)17-27/h1-8,22,30H,9-17H2,(H2,25,26) |
| InChIKey | BZHXDVDRTKOHSX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|