C16H19ClN4O — CID 119118862
4-(4-chlorophenyl)-N'-(furan-3-ylmethyl)piperazine-1-carboximidamide (PubChem CID 119118862) has the molecular formula C16H19ClN4O and a molecular weight of 318.81 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-(furan-3-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-(furan-3-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119118862 |
| Molecular Formula | C16H19ClN4O |
| Molecular Weight | 318.81 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-(furan-3-ylmethyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccoc1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H19ClN4O/c17-14-1-3-15(4-2-14)20-6-8-21(9-7-20)16(18)19-11-13-5-10-22-12-13/h1-5,10,12H,6-9,11H2,(H2,18,19) |
| InChIKey | WWYINDCVGGYJDK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|