C24H31ClN4O2 — CID 111808590
4-(4-chlorophenyl)-N'-[[3-(oxan-4-yloxymethyl)phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 111808590) has the molecular formula C24H31ClN4O2 and a molecular weight of 442.99 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[[3-(oxan-4-yloxymethyl)phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-[[3-(oxan-4-yloxymethyl)phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111808590 |
| Molecular Formula | C24H31ClN4O2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[[3-(oxan-4-yloxymethyl)phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1cccc(COC2CCOCC2)c1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H31ClN4O2/c25-21-4-6-22(7-5-21)28-10-12-29(13-11-28)24(26)27-17-19-2-1-3-20(16-19)18-31-23-8-14-30-15-9-23/h1-7,16,23H,8-15,17-18H2,(H2,26,27) |
| InChIKey | UOEWCUASVYXTHI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|