C18H21ClIN5O2 — CID 111064965
4-(4-chlorophenyl)-N'-[(3-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111064965) has the molecular formula C18H21ClIN5O2 and a molecular weight of 501.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[(3-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-[(3-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111064965 |
| Molecular Formula | C18H21ClIN5O2 |
| Molecular Weight | 501.76 g/mol |
| Exact Mass | 501.04 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[(3-nitrophenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc([N+](=O)[O-])c1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H20ClN5O2.HI/c19-15-4-6-16(7-5-15)22-8-10-23(11-9-22)18(20)21-13-14-2-1-3-17(12-14)24(25)26;/h1-7,12H,8-11,13H2,(H2,20,21);1H |
| InChIKey | PLHWVTZANODQGY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|