C23H32ClN7 — CID 111087001
4-(4-chlorophenyl)-N'-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]piperazine-1-carboximidamide (PubChem CID 111087001) has the molecular formula C23H32ClN7 and a molecular weight of 442.01 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111087001 |
| Molecular Formula | C23H32ClN7 |
| Molecular Weight | 442.01 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]piperazine-1-carboximidamide |
| SMILES | CCN1CCN(c2cc(C/N=C(\N)N3CCN(c4ccc(Cl)cc4)CC3)ccn2)CC1 |
| InChI | InChI=1S/C23H32ClN7/c1-2-28-9-11-30(12-10-28)22-17-19(7-8-26-22)18-27-23(25)31-15-13-29(14-16-31)21-5-3-20(24)4-6-21/h3-8,17H,2,9-16,18H2,1H3,(H2,25,27) |
| InChIKey | ZOPXWFYDXDLESD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.01 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|