C20H22FN7 — CID 111088513
4-(4-fluorophenyl)-N'-[(2-imidazol-1-yl-4-pyridinyl)methyl]piperazine-1-carboximidamide (PubChem CID 111088513) has the molecular formula C20H22FN7 and a molecular weight of 379.44 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[(2-imidazol-1-yl-4-pyridinyl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[(2-imidazol-1-yl-4-pyridinyl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111088513 |
| Molecular Formula | C20H22FN7 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[(2-imidazol-1-yl-4-pyridinyl)methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccnc(-n2ccnc2)c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22FN7/c21-17-1-3-18(4-2-17)26-9-11-27(12-10-26)20(22)25-14-16-5-6-24-19(13-16)28-8-7-23-15-28/h1-8,13,15H,9-12,14H2,(H2,22,25) |
| InChIKey | UMSYISIHUHLMOE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|