C22H30FIN6 — CID 111061860
N'-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111061860) has the molecular formula C22H30FIN6 and a molecular weight of 524.43 g/mol. Its IUPAC name is N'-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111061860 |
| Molecular Formula | C22H30FIN6 |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | N'-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccnc(N2CCN(c3ccc(F)cc3)CC2)c1)N1CCCCC1 |
| InChI | InChI=1S/C22H29FN6.HI/c23-19-4-6-20(7-5-19)27-12-14-28(15-13-27)21-16-18(8-9-25-21)17-26-22(24)29-10-2-1-3-11-29;/h4-9,16H,1-3,10-15,17H2,(H2,24,26);1H |
| InChIKey | IDNQSXRUSOILIF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|