C21H30FIN6 — CID 111061824
2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-1-(2-methylpropyl)guanidine;hydroiodide (PubChem CID 111061824) has the molecular formula C21H30FIN6 and a molecular weight of 512.42 g/mol. Its IUPAC name is 2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-1-(2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-1-(2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111061824 |
| Molecular Formula | C21H30FIN6 |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | 2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-1-(2-methylpropyl)guanidine;hydroiodide |
| SMILES | CC(C)CN/C(N)=N/Cc1ccnc(N2CCN(c3ccc(F)cc3)CC2)c1.I |
| InChI | InChI=1S/C21H29FN6.HI/c1-16(2)14-25-21(23)26-15-17-7-8-24-20(13-17)28-11-9-27(10-12-28)19-5-3-18(22)4-6-19;/h3-8,13,16H,9-12,14-15H2,1-2H3,(H3,23,25,26);1H |
| InChIKey | XNAFOKAMVYQIGC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|