C25H30FIN6 — CID 111061822
1-(3,5-dimethylphenyl)-2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111061822) has the molecular formula C25H30FIN6 and a molecular weight of 560.46 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111061822 |
| Molecular Formula | C25H30FIN6 |
| Molecular Weight | 560.46 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/Cc2ccnc(N3CCN(c4ccc(F)cc4)CC3)c2)c1.I |
| InChI | InChI=1S/C25H29FN6.HI/c1-18-13-19(2)15-22(14-18)30-25(27)29-17-20-7-8-28-24(16-20)32-11-9-31(10-12-32)23-5-3-21(26)4-6-23;/h3-8,13-16H,9-12,17H2,1-2H3,(H3,27,29,30);1H |
| InChIKey | WTLNETXIDVUCFY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|