C21H21FN4O — CID 111091728
1-(3,5-dimethylphenyl)-2-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]guanidine (PubChem CID 111091728) has the molecular formula C21H21FN4O and a molecular weight of 364.42 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111091728 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/Cc2ccnc(Oc3ccc(F)cc3)c2)c1 |
| InChI | InChI=1S/C21H21FN4O/c1-14-9-15(2)11-18(10-14)26-21(23)25-13-16-7-8-24-20(12-16)27-19-5-3-17(22)4-6-19/h3-12H,13H2,1-2H3,(H3,23,25,26) |
| InChIKey | OJBVMWJFTXJOTN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|