C23H26N4O4 — CID 111051154
1-(3,4-dimethoxyphenyl)-2-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]guanidine (PubChem CID 111051154) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111051154 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]guanidine |
| SMILES | CCOc1ccc(Oc2cc(C/N=C(\N)Nc3ccc(OC)c(OC)c3)ccn2)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-4-30-18-6-8-19(9-7-18)31-22-13-16(11-12-25-22)15-26-23(24)27-17-5-10-20(28-2)21(14-17)29-3/h5-14H,4,15H2,1-3H3,(H3,24,26,27) |
| InChIKey | PGYDKMVFDXDCOR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 100.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|