C22H25IN4O2 — CID 111071700
2-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111071700) has the molecular formula C22H25IN4O2 and a molecular weight of 504.37 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111071700 |
| Molecular Formula | C22H25IN4O2 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 2-[[2-(3,4-dimethylphenoxy)-4-pyridinyl]methyl]-1-(3-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1cccc(N/C(N)=N/Cc2ccnc(Oc3ccc(C)c(C)c3)c2)c1.I |
| InChI | InChI=1S/C22H24N4O2.HI/c1-15-7-8-20(11-16(15)2)28-21-12-17(9-10-24-21)14-25-22(23)26-18-5-4-6-19(13-18)27-3;/h4-13H,14H2,1-3H3,(H3,23,25,26);1H |
| InChIKey | BYLBBVDDTLGERE-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|