C20H27FN6 — CID 111061819
2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-1-propylguanidine (PubChem CID 111061819) has the molecular formula C20H27FN6 and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-1-propylguanidine.
| Compound Name | 2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-1-propylguanidine |
|---|---|
| PubChem CID | 111061819 |
| Molecular Formula | C20H27FN6 |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]-1-propylguanidine |
| SMILES | CCCN/C(N)=N/Cc1ccnc(N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C20H27FN6/c1-2-8-24-20(22)25-15-16-7-9-23-19(14-16)27-12-10-26(11-13-27)18-5-3-17(21)4-6-18/h3-7,9,14H,2,8,10-13,15H2,1H3,(H3,22,24,25) |
| InChIKey | KZEUCLYZRSUSOR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|