C25H29FN6 — CID 111061843
1-(3-ethylphenyl)-2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]guanidine (PubChem CID 111061843) has the molecular formula C25H29FN6 and a molecular weight of 432.55 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-(3-ethylphenyl)-2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111061843 |
| Molecular Formula | C25H29FN6 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 1-(3-ethylphenyl)-2-[[2-[4-(4-fluorophenyl)piperazin-1-yl]-4-pyridinyl]methyl]guanidine |
| SMILES | CCc1cccc(N/C(N)=N/Cc2ccnc(N3CCN(c4ccc(F)cc4)CC3)c2)c1 |
| InChI | InChI=1S/C25H29FN6/c1-2-19-4-3-5-22(16-19)30-25(27)29-18-20-10-11-28-24(17-20)32-14-12-31(13-15-32)23-8-6-21(26)7-9-23/h3-11,16-17H,2,12-15,18H2,1H3,(H3,27,29,30) |
| InChIKey | QXGPOPDANILGAR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|