C18H32N6 — CID 111049024
1-hexyl-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine (PubChem CID 111049024) has the molecular formula C18H32N6 and a molecular weight of 332.50 g/mol. Its IUPAC name is 1-hexyl-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-hexyl-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111049024 |
| Molecular Formula | C18H32N6 |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 1-hexyl-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
| SMILES | CCCCCCN/C(N)=N/Cc1ccnc(N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C18H32N6/c1-3-4-5-6-8-21-18(19)22-15-16-7-9-20-17(14-16)24-12-10-23(2)11-13-24/h7,9,14H,3-6,8,10-13,15H2,1-2H3,(H3,19,21,22) |
| InChIKey | LVZLHMRXXXIWFR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|