C24H36N6 — CID 111049066
1-butyl-3-[(4-methylphenyl)methyl]-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine (PubChem CID 111049066) has the molecular formula C24H36N6 and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-butyl-3-[(4-methylphenyl)methyl]-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-butyl-3-[(4-methylphenyl)methyl]-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111049066 |
| Molecular Formula | C24H36N6 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 1-butyl-3-[(4-methylphenyl)methyl]-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
| SMILES | CCCCN/C(=N\Cc1ccnc(N2CCN(C)CC2)c1)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C24H36N6/c1-4-5-11-26-24(27-18-21-8-6-20(2)7-9-21)28-19-22-10-12-25-23(17-22)30-15-13-29(3)14-16-30/h6-10,12,17H,4-5,11,13-16,18-19H2,1-3H3,(H2,26,27,28) |
| InChIKey | YWELEMAZWFHYAC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|