C20H28N6 — CID 111049010
2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-1-(2-phenylethyl)guanidine (PubChem CID 111049010) has the molecular formula C20H28N6 and a molecular weight of 352.49 g/mol. Its IUPAC name is 2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-1-(2-phenylethyl)guanidine.
| Compound Name | 2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-1-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111049010 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]-1-(2-phenylethyl)guanidine |
| SMILES | CN1CCN(c2cc(C/N=C(\N)NCCc3ccccc3)ccn2)CC1 |
| InChI | InChI=1S/C20H28N6/c1-25-11-13-26(14-12-25)19-15-18(8-9-22-19)16-24-20(21)23-10-7-17-5-3-2-4-6-17/h2-6,8-9,15H,7,10-14,16H2,1H3,(H3,21,23,24) |
| InChIKey | WBGCSSRXKOCSAC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|