C17H30N6O — CID 111049036
1-(3-ethoxypropyl)-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine (PubChem CID 111049036) has the molecular formula C17H30N6O and a molecular weight of 334.47 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-(3-ethoxypropyl)-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111049036 |
| Molecular Formula | C17H30N6O |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 1-(3-ethoxypropyl)-2-[[2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
| SMILES | CCOCCCN/C(N)=N/Cc1ccnc(N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C17H30N6O/c1-3-24-12-4-6-20-17(18)21-14-15-5-7-19-16(13-15)23-10-8-22(2)9-11-23/h5,7,13H,3-4,6,8-12,14H2,1-2H3,(H3,18,20,21) |
| InChIKey | GGNBRMFNKIKSPY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|