C23H29F2N5O — CID 111068443
N'-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide (PubChem CID 111068443) has the molecular formula C23H29F2N5O and a molecular weight of 429.52 g/mol. Its IUPAC name is N'-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111068443 |
| Molecular Formula | C23H29F2N5O |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | N'-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(N2CCC(O)CC2)c(F)c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H29F2N5O/c24-18-2-4-19(5-3-18)28-11-13-30(14-12-28)23(26)27-16-17-1-6-22(21(25)15-17)29-9-7-20(31)8-10-29/h1-6,15,20,31H,7-14,16H2,(H2,26,27) |
| InChIKey | HMLFEZDQHSEZRQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|