C19H23FIN5O — CID 111030255
4-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111030255) has the molecular formula C19H23FIN5O and a molecular weight of 483.33 g/mol. Its IUPAC name is 4-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | 4-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111030255 |
| Molecular Formula | C19H23FIN5O |
| Molecular Weight | 483.33 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | 4-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | I.NC(=O)c1ccc(C/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H22FN5O.HI/c20-16-5-7-17(8-6-16)24-9-11-25(12-10-24)19(22)23-13-14-1-3-15(4-2-14)18(21)26;/h1-8H,9-13H2,(H2,21,26)(H2,22,23);1H |
| InChIKey | JSJLLKKSKLKFJL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|