C20H26FIN4OS — CID 120974042
4-(4-fluorophenyl)-N'-[[4-(methylsulfinylmethyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 120974042) has the molecular formula C20H26FIN4OS and a molecular weight of 516.42 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[[4-(methylsulfinylmethyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-fluorophenyl)-N'-[[4-(methylsulfinylmethyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120974042 |
| Molecular Formula | C20H26FIN4OS |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[[4-(methylsulfinylmethyl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | CS(=O)Cc1ccc(C/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)cc1.I |
| InChI | InChI=1S/C20H25FN4OS.HI/c1-27(26)15-17-4-2-16(3-5-17)14-23-20(22)25-12-10-24(11-13-25)19-8-6-18(21)7-9-19;/h2-9H,10-15H2,1H3,(H2,22,23);1H |
| InChIKey | JZMWEXLLQXFENJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|