C21H27FN4O — CID 111054161
N'-[[4-(ethoxymethyl)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide (PubChem CID 111054161) has the molecular formula C21H27FN4O and a molecular weight of 370.47 g/mol. Its IUPAC name is N'-[[4-(ethoxymethyl)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[[4-(ethoxymethyl)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111054161 |
| Molecular Formula | C21H27FN4O |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | N'-[[4-(ethoxymethyl)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide |
| SMILES | CCOCc1ccc(C/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C21H27FN4O/c1-2-27-16-18-5-3-17(4-6-18)15-24-21(23)26-13-11-25(12-14-26)20-9-7-19(22)8-10-20/h3-10H,2,11-16H2,1H3,(H2,23,24) |
| InChIKey | CEAGVYNMQSWBAQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|