C20H26FN5 — CID 111033194
N'-[[4-(dimethylamino)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide (PubChem CID 111033194) has the molecular formula C20H26FN5 and a molecular weight of 355.46 g/mol. Its IUPAC name is N'-[[4-(dimethylamino)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[[4-(dimethylamino)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111033194 |
| Molecular Formula | C20H26FN5 |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | N'-[[4-(dimethylamino)phenyl]methyl]-4-(4-fluorophenyl)piperazine-1-carboximidamide |
| SMILES | CN(C)c1ccc(C/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H26FN5/c1-24(2)18-7-3-16(4-8-18)15-23-20(22)26-13-11-25(12-14-26)19-9-5-17(21)6-10-19/h3-10H,11-15H2,1-2H3,(H2,22,23) |
| InChIKey | AFXKHKWCKXYHDX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 48.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|