C21H25F2N5O — CID 111083309
2-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]-3-(4-fluorophenyl)propanamide (PubChem CID 111083309) has the molecular formula C21H25F2N5O and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]-3-(4-fluorophenyl)propanamide.
| Compound Name | 2-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 111083309 |
| Molecular Formula | C21H25F2N5O |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]-3-(4-fluorophenyl)propanamide |
| SMILES | NC(=O)C(C/N=C(\N)N1CCN(c2ccc(F)cc2)CC1)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H25F2N5O/c22-17-3-1-15(2-4-17)13-16(20(24)29)14-26-21(25)28-11-9-27(10-12-28)19-7-5-18(23)6-8-19/h1-8,16H,9-14H2,(H2,24,29)(H2,25,26) |
| InChIKey | MNMDRCBDXRFQNW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|