C23H30FIN6O — CID 111076685
N-[3-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide (PubChem CID 111076685) has the molecular formula C23H30FIN6O and a molecular weight of 552.44 g/mol. Its IUPAC name is N-[3-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111076685 |
| Molecular Formula | C23H30FIN6O |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | N-[3-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]phenyl]pyrrolidine-1-carboxamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(NC(=O)N2CCCC2)c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H29FN6O.HI/c24-19-6-8-21(9-7-19)28-12-14-29(15-13-28)22(25)26-17-18-4-3-5-20(16-18)27-23(31)30-10-1-2-11-30;/h3-9,16H,1-2,10-15,17H2,(H2,25,26)(H,27,31);1H |
| InChIKey | NIGCRQNDOPNHKN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|