C23H28FN5O — CID 111046891
N-[3-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide (PubChem CID 111046891) has the molecular formula C23H28FN5O and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[3-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide.
| Compound Name | N-[3-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 111046891 |
| Molecular Formula | C23H28FN5O |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | N-[3-[[[amino-[4-(4-fluorophenyl)piperazin-1-yl]methylidene]amino]methyl]phenyl]cyclobutanecarboxamide |
| SMILES | N/C(=N\Cc1cccc(NC(=O)C2CCC2)c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C23H28FN5O/c24-19-7-9-21(10-8-19)28-11-13-29(14-12-28)23(25)26-16-17-3-1-6-20(15-17)27-22(30)18-4-2-5-18/h1,3,6-10,15,18H,2,4-5,11-14,16H2,(H2,25,26)(H,27,30) |
| InChIKey | PJVBOKPENXRWDT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|