C21H24FN5O — CID 120728079
4-(4-fluorophenyl)-N'-[[3-(2-oxoazetidin-1-yl)phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 120728079) has the molecular formula C21H24FN5O and a molecular weight of 381.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[[3-(2-oxoazetidin-1-yl)phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[[3-(2-oxoazetidin-1-yl)phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 120728079 |
| Molecular Formula | C21H24FN5O |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[[3-(2-oxoazetidin-1-yl)phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1cccc(N2CCC2=O)c1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H24FN5O/c22-17-4-6-18(7-5-17)25-10-12-26(13-11-25)21(23)24-15-16-2-1-3-19(14-16)27-9-8-20(27)28/h1-7,14H,8-13,15H2,(H2,23,24) |
| InChIKey | ROCMNTSMMPNBAZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|